C20H16N2O3S2 — CID 7434475
[(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-phenylsulfanylacetate (PubChem CID 7434475) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-phenylsulfanylacetate.
| Compound Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 7434475 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-phenylsulfanylacetate |
| SMILES | CN1/C(=C(\C#N)C(=O)COC(=O)CSc2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C20H16N2O3S2/c1-22-16-9-5-6-10-18(16)27-20(22)15(11-21)17(23)12-25-19(24)13-26-14-7-3-2-4-8-14/h2-10H,12-13H2,1H3/b20-15- |
| InChIKey | NVNHTPRADFVTJA-HKWRFOASSA-N |
| XLogP | 3.87 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|