C21H18N2O3S — CID 7432695
[(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 3-phenylpropanoate (PubChem CID 7432695) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 3-phenylpropanoate.
| Compound Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 7432695 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 3-phenylpropanoate |
| SMILES | CN1/C(=C(\C#N)C(=O)COC(=O)CCc2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C21H18N2O3S/c1-23-17-9-5-6-10-19(17)27-21(23)16(13-22)18(24)14-26-20(25)12-11-15-7-3-2-4-8-15/h2-10H,11-12,14H2,1H3/b21-16- |
| InChIKey | KLYFLHSICNYITG-PGMHBOJBSA-N |
| XLogP | 3.71 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|