C23H17N3O3S — CID 7533377
[(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-methylquinoline-4-carboxylate (PubChem CID 7533377) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-methylquinoline-4-carboxylate.
| Compound Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7533377 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 2-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)/C(C#N)=C2\Sc3ccccc3N2C)c2ccccc2n1 |
| InChI | InChI=1S/C23H17N3O3S/c1-14-11-16(15-7-3-4-8-18(15)25-14)23(28)29-13-20(27)17(12-24)22-26(2)19-9-5-6-10-21(19)30-22/h3-11H,13H2,1-2H3/b22-17- |
| InChIKey | IGZCTGPZJYJFKY-XLNRJJMWSA-N |
| XLogP | 4.25 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|