C18H12Cl2N2O2S — CID 7434169
(2Z)-4-(2,4-dichlorophenoxy)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 7434169) has the molecular formula C18H12Cl2N2O2S and a molecular weight of 391.28 g/mol. Its IUPAC name is (2Z)-4-(2,4-dichlorophenoxy)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | (2Z)-4-(2,4-dichlorophenoxy)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7434169 |
| Molecular Formula | C18H12Cl2N2O2S |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | (2Z)-4-(2,4-dichlorophenoxy)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | CN1/C(=C(\C#N)C(=O)COc2ccc(Cl)cc2Cl)Sc2ccccc21 |
| InChI | InChI=1S/C18H12Cl2N2O2S/c1-22-14-4-2-3-5-17(14)25-18(22)12(9-21)15(23)10-24-16-7-6-11(19)8-13(16)20/h2-8H,10H2,1H3/b18-12- |
| InChIKey | NGEJKQZXWPZPBE-PDGQHHTCSA-N |
| XLogP | 4.92 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|