C17H17N5O2S3 — CID 4806370
4-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 4806370) has the molecular formula C17H17N5O2S3 and a molecular weight of 419.56 g/mol. Its IUPAC name is 4-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | 4-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 4806370 |
| Molecular Formula | C17H17N5O2S3 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 4-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | COCCNc1nnc(SCC(=O)C(C#N)=C2Sc3ccccc3N2C)s1 |
| InChI | InChI=1S/C17H17N5O2S3/c1-22-12-5-3-4-6-14(12)26-15(22)11(9-18)13(23)10-25-17-21-20-16(27-17)19-7-8-24-2/h3-6H,7-8,10H2,1-2H3,(H,19,20) |
| InChIKey | WHUJLEUJAOVYEB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|