C16H22N4O2S2 — CID 43036481
N-ethyl-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide (PubChem CID 43036481) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-ethyl-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide.
| Compound Name | N-ethyl-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43036481 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-ethyl-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
| SMILES | CCN(C(=O)CSc1nnc(NCCOC)s1)c1ccccc1C |
| InChI | InChI=1S/C16H22N4O2S2/c1-4-20(13-8-6-5-7-12(13)2)14(21)11-23-16-19-18-15(24-16)17-9-10-22-3/h5-8H,4,9-11H2,1-3H3,(H,17,18) |
| InChIKey | CVYSXZYDIGDUKM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|