C12H15N3OS2 — CID 4819058
5-benzylsulfanyl-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 4819058) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 5-benzylsulfanyl-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-benzylsulfanyl-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 4819058 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-benzylsulfanyl-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C12H15N3OS2/c1-16-8-7-13-11-14-15-12(18-11)17-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,13,14) |
| InChIKey | GEXGVDKNGRJHIB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|