C11H15N5OS2 — CID 119050665
5-[(6-amino-2-pyridinyl)methylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 119050665) has the molecular formula C11H15N5OS2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 5-[(6-amino-2-pyridinyl)methylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(6-amino-2-pyridinyl)methylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 119050665 |
| Molecular Formula | C11H15N5OS2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-[(6-amino-2-pyridinyl)methylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(SCc2cccc(N)n2)s1 |
| InChI | InChI=1S/C11H15N5OS2/c1-17-6-5-13-10-15-16-11(19-10)18-7-8-3-2-4-9(12)14-8/h2-4H,5-7H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | KCMYIITYBJUCTR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|