C13H17N3O3S3 — CID 55479428
5-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 55479428) has the molecular formula C13H17N3O3S3 and a molecular weight of 359.50 g/mol. Its IUPAC name is 5-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 55479428 |
| Molecular Formula | C13H17N3O3S3 |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 5-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(SCCS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C13H17N3O3S3/c1-19-8-7-14-12-15-16-13(21-12)20-9-10-22(17,18)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H,14,15) |
| InChIKey | NHUFUDJZEJVOPA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|