C13H17N3OS3 — CID 7969896
N-(2-methoxyethyl)-5-[(4-methylsulfanylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 7969896) has the molecular formula C13H17N3OS3 and a molecular weight of 327.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[(4-methylsulfanylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-5-[(4-methylsulfanylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 7969896 |
| Molecular Formula | C13H17N3OS3 |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-(2-methoxyethyl)-5-[(4-methylsulfanylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(SCc2ccc(SC)cc2)s1 |
| InChI | InChI=1S/C13H17N3OS3/c1-17-8-7-14-12-15-16-13(20-12)19-9-10-3-5-11(18-2)6-4-10/h3-6H,7-9H2,1-2H3,(H,14,15) |
| InChIKey | VXJJXGXDAZGREO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|