C17H20N3OS+ — CID 9249700
(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxo-4-piperidin-1-ium-1-ylbutanenitrile (PubChem CID 9249700) has the molecular formula C17H20N3OS+ and a molecular weight of 314.43 g/mol. Its IUPAC name is (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxo-4-piperidin-1-ium-1-ylbutanenitrile.
| Compound Name | (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxo-4-piperidin-1-ium-1-ylbutanenitrile |
|---|---|
| PubChem CID | 9249700 |
| Molecular Formula | C17H20N3OS+ |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxo-4-piperidin-1-ium-1-ylbutanenitrile |
| SMILES | CN1/C(=C(\C#N)C(=O)C[NH+]2CCCCC2)Sc2ccccc21 |
| InChI | InChI=1S/C17H19N3OS/c1-19-14-7-3-4-8-16(14)22-17(19)13(11-18)15(21)12-20-9-5-2-6-10-20/h3-4,7-8H,2,5-6,9-10,12H2,1H3/p+1/b17-13- |
| InChIKey | BBSRUUALQMBSRY-LGMDPLHJSA-O |
| XLogP | 1.60 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|