C22H19N5OS2 — CID 4806408
4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 4806408) has the molecular formula C22H19N5OS2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 4806408 |
| Molecular Formula | C22H19N5OS2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | Cc1nnc(SCC(=O)C(C#N)=C2Sc3ccccc3N2C)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H19N5OS2/c1-15-24-25-22(27(15)13-16-8-4-3-5-9-16)29-14-19(28)17(12-23)21-26(2)18-10-6-7-11-20(18)30-21/h3-11H,13-14H2,1-2H3 |
| InChIKey | XJHNVVMOUQMQIL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|