C19H20N4O2S — CID 32578079
2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-phenylmethoxyacetamide (PubChem CID 32578079) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-phenylmethoxyacetamide.
| Compound Name | 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 32578079 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-phenylmethoxyacetamide |
| SMILES | Cc1nnc(SCC(=O)NOCc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-15-20-21-19(23(15)12-16-8-4-2-5-9-16)26-14-18(24)22-25-13-17-10-6-3-7-11-17/h2-11H,12-14H2,1H3,(H,22,24) |
| InChIKey | MNMQNLKIPPMFBE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|