C16H21N3O2S — CID 78764261
butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 78764261) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 78764261 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CCCCOC(=O)CSc1nnc(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-3-4-10-21-15(20)12-22-16-18-17-13(2)19(16)11-14-8-6-5-7-9-14/h5-9H,3-4,10-12H2,1-2H3 |
| InChIKey | CLCGNAQOJKFGGN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|