C19H19N3O2S — CID 1151992
ethyl 2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 1151992) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is ethyl 2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | ethyl 2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 1151992 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | ethyl 2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(-c2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-2-24-17(23)14-25-19-21-20-18(16-11-7-4-8-12-16)22(19)13-15-9-5-3-6-10-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | CDBCPHKJBMRFHR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |