C17H23N3O2S — CID 56807150
butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]propanoate (PubChem CID 56807150) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]propanoate.
| Compound Name | butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 56807150 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | butyl 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]propanoate |
| SMILES | CCCCOC(=O)C(C)Sc1nnc(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-5-11-22-16(21)13(2)23-17-19-18-14(3)20(17)12-15-9-7-6-8-10-15/h6-10,13H,4-5,11-12H2,1-3H3 |
| InChIKey | SYIUJGJVWPTVPZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|