C20H13N3O3S2 — CID 7531970
[(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 1,3-benzothiazole-6-carboxylate (PubChem CID 7531970) has the molecular formula C20H13N3O3S2 and a molecular weight of 407.48 g/mol. Its IUPAC name is [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 1,3-benzothiazole-6-carboxylate.
| Compound Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 7531970 |
| Molecular Formula | C20H13N3O3S2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | [(3Z)-3-cyano-3-(3-methyl-1,3-benzothiazol-2-ylidene)-2-oxopropyl] 1,3-benzothiazole-6-carboxylate |
| SMILES | CN1/C(=C(\C#N)C(=O)COC(=O)c2ccc3ncsc3c2)Sc2ccccc21 |
| InChI | InChI=1S/C20H13N3O3S2/c1-23-15-4-2-3-5-17(15)28-19(23)13(9-21)16(24)10-26-20(25)12-6-7-14-18(8-12)27-11-22-14/h2-8,11H,10H2,1H3/b19-13- |
| InChIKey | KBCWJFMDTOHCAJ-UYRXBGFRSA-N |
| XLogP | 4.00 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|