C22H14N2O3S2 — CID 2597277
(2-oxo-2-phenothiazin-10-ylethyl) 1,3-benzothiazole-6-carboxylate (PubChem CID 2597277) has the molecular formula C22H14N2O3S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 1,3-benzothiazole-6-carboxylate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 2597277 |
| Molecular Formula | C22H14N2O3S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 1,3-benzothiazole-6-carboxylate |
| SMILES | O=C(OCC(=O)N1c2ccccc2Sc2ccccc21)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C22H14N2O3S2/c25-21(12-27-22(26)14-9-10-15-20(11-14)28-13-23-15)24-16-5-1-3-7-18(16)29-19-8-4-2-6-17(19)24/h1-11,13H,12H2 |
| InChIKey | KGTBFATVCQJBTA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |