C15H13N5OS2 — CID 18775966
(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-oxobutanenitrile (PubChem CID 18775966) has the molecular formula C15H13N5OS2 and a molecular weight of 343.44 g/mol. Its IUPAC name is (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-oxobutanenitrile.
| Compound Name | (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 18775966 |
| Molecular Formula | C15H13N5OS2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-oxobutanenitrile |
| SMILES | CN1/C(=C(\C#N)C(=O)CSc2nncn2C)Sc2ccccc21 |
| InChI | InChI=1S/C15H13N5OS2/c1-19-9-17-18-15(19)22-8-12(21)10(7-16)14-20(2)11-5-3-4-6-13(11)23-14/h3-6,9H,8H2,1-2H3/b14-10- |
| InChIKey | RERWAPWAHJMXIP-UVTDQMKNSA-N |
| XLogP | 2.45 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|