C21H15Cl2NO2S — CID 2898826
2-(2,4-dichlorophenoxy)-1-phenothiazin-10-ylpropan-1-one (PubChem CID 2898826) has the molecular formula C21H15Cl2NO2S and a molecular weight of 416.33 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-phenothiazin-10-ylpropan-1-one.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-phenothiazin-10-ylpropan-1-one |
|---|---|
| PubChem CID | 2898826 |
| Molecular Formula | C21H15Cl2NO2S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-phenothiazin-10-ylpropan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C21H15Cl2NO2S/c1-13(26-18-11-10-14(22)12-15(18)23)21(25)24-16-6-2-4-8-19(16)27-20-9-5-3-7-17(20)24/h2-13H,1H3 |
| InChIKey | UMHQWRMZPPFGGZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |