C19H15Cl2NO3 — CID 102552616
1-[2-(2,4-dichlorophenoxy)propanoyl]-2-methylindole-3-carbaldehyde (PubChem CID 102552616) has the molecular formula C19H15Cl2NO3 and a molecular weight of 376.24 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)propanoyl]-2-methylindole-3-carbaldehyde.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)propanoyl]-2-methylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 102552616 |
| Molecular Formula | C19H15Cl2NO3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)propanoyl]-2-methylindole-3-carbaldehyde |
| SMILES | Cc1c(C=O)c2ccccc2n1C(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2NO3/c1-11-15(10-23)14-5-3-4-6-17(14)22(11)19(24)12(2)25-18-8-7-13(20)9-16(18)21/h3-10,12H,1-2H3 |
| InChIKey | OBEAFNIUYXTUBJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|