C18H13Cl2NO4 — CID 99969716
1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]indole-3-carboxylic acid (PubChem CID 99969716) has the molecular formula C18H13Cl2NO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is 1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]indole-3-carboxylic acid.
| Compound Name | 1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 99969716 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]indole-3-carboxylic acid |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)n1cc(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C18H13Cl2NO4/c1-10(25-16-7-6-11(19)8-14(16)20)17(22)21-9-13(18(23)24)12-4-2-3-5-15(12)21/h2-10H,1H3,(H,23,24)/t10-/m0/s1 |
| InChIKey | AJYIIKLEAQVHSE-JTQLQIEISA-N |
| XLogP | 4.75 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |