C16H11Cl3O5 — CID 54855091
5-chloro-2-[2-(2,4-dichlorophenoxy)propanoyloxy]benzoic acid (PubChem CID 54855091) has the molecular formula C16H11Cl3O5 and a molecular weight of 389.62 g/mol. Its IUPAC name is 5-chloro-2-[2-(2,4-dichlorophenoxy)propanoyloxy]benzoic acid.
| Compound Name | 5-chloro-2-[2-(2,4-dichlorophenoxy)propanoyloxy]benzoic acid |
|---|---|
| PubChem CID | 54855091 |
| Molecular Formula | C16H11Cl3O5 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 5-chloro-2-[2-(2,4-dichlorophenoxy)propanoyloxy]benzoic acid |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Oc1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C16H11Cl3O5/c1-8(23-14-5-3-10(18)7-12(14)19)16(22)24-13-4-2-9(17)6-11(13)15(20)21/h2-8H,1H3,(H,20,21) |
| InChIKey | AQKKMKVIIVIYAU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|