C17H16Cl2O4 — CID 4876645
(2-methoxy-4-methylphenyl) 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 4876645) has the molecular formula C17H16Cl2O4 and a molecular weight of 355.22 g/mol. Its IUPAC name is (2-methoxy-4-methylphenyl) 2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | (2-methoxy-4-methylphenyl) 2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 4876645 |
| Molecular Formula | C17H16Cl2O4 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (2-methoxy-4-methylphenyl) 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | COc1cc(C)ccc1OC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2O4/c1-10-4-6-15(16(8-10)21-3)23-17(20)11(2)22-14-7-5-12(18)9-13(14)19/h4-9,11H,1-3H3 |
| InChIKey | YSGZHQYHDRDVGC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|