C15H11Cl2NO5 — CID 1013718
(2-nitrophenyl) (2S)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 1013718) has the molecular formula C15H11Cl2NO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is (2-nitrophenyl) (2S)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | (2-nitrophenyl) (2S)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 1013718 |
| Molecular Formula | C15H11Cl2NO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (2-nitrophenyl) (2S)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11Cl2NO5/c1-9(22-13-7-6-10(16)8-11(13)17)15(19)23-14-5-3-2-4-12(14)18(20)21/h2-9H,1H3/t9-/m0/s1 |
| InChIKey | WIPNJRQJWDJSGO-VIFPVBQESA-N |
| XLogP | 4.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|