C20H16Cl2N2O3 — CID 6977164
4-benzylidene-2-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-5-methylpyrazol-3-one (PubChem CID 6977164) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is 4-benzylidene-2-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-5-methylpyrazol-3-one.
| Compound Name | 4-benzylidene-2-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 6977164 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-benzylidene-2-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(C(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)C(=O)C1=Cc1ccccc1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-12-16(10-14-6-4-3-5-7-14)20(26)24(23-12)19(25)13(2)27-18-9-8-15(21)11-17(18)22/h3-11,13H,1-2H3/t13-/m1/s1 |
| InChIKey | BIXJJFLJIHMJHV-CYBMUJFWSA-N |
| XLogP | 4.59 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|