C17H12Cl2N2O4 — CID 1010977
(2S)-2-(2,4-dichlorophenoxy)-N-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 1010977) has the molecular formula C17H12Cl2N2O4 and a molecular weight of 379.20 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 1010977 |
| Molecular Formula | C17H12Cl2N2O4 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H12Cl2N2O4/c1-9(25-14-7-6-10(18)8-13(14)19)15(22)20-21-16(23)11-4-2-3-5-12(11)17(21)24/h2-9H,1H3,(H,20,22)/t9-/m0/s1 |
| InChIKey | TZMWRGXFVHOKKL-VIFPVBQESA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|