C17H17Cl2NO4S — CID 55734024
N-[2-(benzenesulfonyl)ethyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 55734024) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 55734024 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-12(24-16-8-7-13(18)11-15(16)19)17(21)20-9-10-25(22,23)14-5-3-2-4-6-14/h2-8,11-12H,9-10H2,1H3,(H,20,21) |
| InChIKey | ZSYXFBSVJBRTHZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |