C12H13Cl2NO5 — CID 66165822
3-[2-(2,4-dichlorophenoxy)propanoylamino]-2-hydroxypropanoic acid (PubChem CID 66165822) has the molecular formula C12H13Cl2NO5 and a molecular weight of 322.14 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)propanoylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)propanoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66165822 |
| Molecular Formula | C12H13Cl2NO5 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)propanoylamino]-2-hydroxypropanoic acid |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NCC(O)C(=O)O |
| InChI | InChI=1S/C12H13Cl2NO5/c1-6(11(17)15-5-9(16)12(18)19)20-10-3-2-7(13)4-8(10)14/h2-4,6,9,16H,5H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | HDIMZFJANRRTCJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |