C15H19Cl2NO4 — CID 3825551
2-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylpentanoic acid (PubChem CID 3825551) has the molecular formula C15H19Cl2NO4 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 3825551 |
| Molecular Formula | C15H19Cl2NO4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(C)Oc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C15H19Cl2NO4/c1-4-8(2)13(15(20)21)18-14(19)9(3)22-12-6-5-10(16)7-11(12)17/h5-9,13H,4H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | PPWRYSCIXUKDBC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |