C24H24Cl4N4O4 — CID 124538013
(2R)-2-(2,4-dichlorophenoxy)-N-[[4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]hydrazinylidene]cyclohexylidene]amino]propanamide (PubChem CID 124538013) has the molecular formula C24H24Cl4N4O4 and a molecular weight of 574.29 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-[[4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]hydrazinylidene]cyclohexylidene]amino]propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-[[4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]hydrazinylidene]cyclohexylidene]amino]propanamide |
|---|---|
| PubChem CID | 124538013 |
| Molecular Formula | C24H24Cl4N4O4 |
| Molecular Weight | 574.29 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-[[4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]hydrazinylidene]cyclohexylidene]amino]propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NN=C1CCC(=NNC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C24H24Cl4N4O4/c1-13(35-21-9-3-15(25)11-19(21)27)23(33)31-29-17-5-7-18(8-6-17)30-32-24(34)14(2)36-22-10-4-16(26)12-20(22)28/h3-4,9-14H,5-8H2,1-2H3,(H,31,33)(H,32,34)/b29-17-,30-18+/t13-,14+ |
| InChIKey | JODWIKLPMKKDBJ-PYYGADJDSA-N |
| XLogP | 6.05 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.29 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|