C18H15Cl2N3O3 — CID 1337108
(2R)-2-(2,4-dichlorophenoxy)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)propanamide (PubChem CID 1337108) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 1337108 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c1-11(26-15-8-7-12(19)9-14(15)20)18(25)21-16-10-17(24)23(22-16)13-5-3-2-4-6-13/h2-9,11H,10H2,1H3,(H,21,22,25)/t11-/m1/s1 |
| InChIKey | HVLZJTHVKXQUHZ-LLVKDONJSA-N |
| XLogP | 3.63 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|