C23H19Cl2N3O3S — CID 4928309
N'-[4-(2,4-dichlorophenoxy)butanoyl]phenothiazine-10-carbohydrazide (PubChem CID 4928309) has the molecular formula C23H19Cl2N3O3S and a molecular weight of 488.40 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]phenothiazine-10-carbohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]phenothiazine-10-carbohydrazide |
|---|---|
| PubChem CID | 4928309 |
| Molecular Formula | C23H19Cl2N3O3S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]phenothiazine-10-carbohydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C23H19Cl2N3O3S/c24-15-11-12-19(16(25)14-15)31-13-5-10-22(29)26-27-23(30)28-17-6-1-3-8-20(17)32-21-9-4-2-7-18(21)28/h1-4,6-9,11-12,14H,5,10,13H2,(H,26,29)(H,27,30) |
| InChIKey | OQKZQUDNNWIFIF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|