C21H24Cl2N2O4 — CID 4958695
4-(2,4-dichlorophenoxy)-N'-[2-(2,6-dimethylphenoxy)propanoyl]butanehydrazide (PubChem CID 4958695) has the molecular formula C21H24Cl2N2O4 and a molecular weight of 439.34 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N'-[2-(2,6-dimethylphenoxy)propanoyl]butanehydrazide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N'-[2-(2,6-dimethylphenoxy)propanoyl]butanehydrazide |
|---|---|
| PubChem CID | 4958695 |
| Molecular Formula | C21H24Cl2N2O4 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N'-[2-(2,6-dimethylphenoxy)propanoyl]butanehydrazide |
| SMILES | Cc1cccc(C)c1OC(C)C(=O)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N2O4/c1-13-6-4-7-14(2)20(13)29-15(3)21(27)25-24-19(26)8-5-11-28-18-10-9-16(22)12-17(18)23/h4,6-7,9-10,12,15H,5,8,11H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | VZXDUIHSLDKWBI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|