C18H25Cl2N3O5 — CID 55560475
tert-butyl N-[1-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 55560475) has the molecular formula C18H25Cl2N3O5 and a molecular weight of 434.32 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 55560475 |
| Molecular Formula | C18H25Cl2N3O5 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | tert-butyl N-[1-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H25Cl2N3O5/c1-11(21-17(26)28-18(2,3)4)16(25)23-22-15(24)6-5-9-27-14-8-7-12(19)10-13(14)20/h7-8,10-11H,5-6,9H2,1-4H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | NCVIFYVBKRCHRH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|