C24H26Cl2N2O4 — CID 4242505
4-(2,4-dichlorophenoxy)-N'-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]butanehydrazide (PubChem CID 4242505) has the molecular formula C24H26Cl2N2O4 and a molecular weight of 477.39 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N'-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]butanehydrazide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N'-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 4242505 |
| Molecular Formula | C24H26Cl2N2O4 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N'-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]butanehydrazide |
| SMILES | Cc1cc2occ(CC(=O)NNC(=O)CCCOc3ccc(Cl)cc3Cl)c2cc1C(C)C |
| InChI | InChI=1S/C24H26Cl2N2O4/c1-14(2)18-12-19-16(13-32-22(19)9-15(18)3)10-24(30)28-27-23(29)5-4-8-31-21-7-6-17(25)11-20(21)26/h6-7,9,11-14H,4-5,8,10H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | BPUIGLGPEHVFMG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|