C12H10N2S — CID 23521305
5-methylpyrido[3,4-b][1,4]benzothiazine (PubChem CID 23521305) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-methylpyrido[3,4-b][1,4]benzothiazine.
| Compound Name | 5-methylpyrido[3,4-b][1,4]benzothiazine |
|---|---|
| PubChem CID | 23521305 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 5-methylpyrido[3,4-b][1,4]benzothiazine |
| SMILES | CN1c2ccccc2Sc2cnccc21 |
| InChI | InChI=1S/C12H10N2S/c1-14-9-4-2-3-5-11(9)15-12-8-13-7-6-10(12)14/h2-8H,1H3 |
| InChIKey | CDGCQPZVMIALJZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |