C16H20N4S — CID 16742386
N,N-diethyl-2-(2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl)ethanamine (PubChem CID 16742386) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N,N-diethyl-2-(2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl)ethanamine |
|---|---|
| PubChem CID | 16742386 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N,N-diethyl-2-(2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl)ethanamine |
| SMILES | CCN(CC)CCN1c2ccncc2Sc2ccncc21 |
| InChI | InChI=1S/C16H20N4S/c1-3-19(4-2)9-10-20-13-5-7-18-12-16(13)21-15-6-8-17-11-14(15)20/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | NNXBOQAIJLBHLX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |