C13H9NS — CID 146209378
10-methyl-6,7-didehydrophenothiazine (PubChem CID 146209378) has the molecular formula C13H9NS and a molecular weight of 211.29 g/mol. Its IUPAC name is 10-methyl-6,7-didehydrophenothiazine.
| Compound Name | 10-methyl-6,7-didehydrophenothiazine |
|---|---|
| PubChem CID | 146209378 |
| Molecular Formula | C13H9NS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 10-methyl-6,7-didehydrophenothiazine |
| SMILES | CN1c2ccc#cc2Sc2ccccc21 |
| InChI | InChI=1S/C13H9NS/c1-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-4,6-8H,1H3 |
| InChIKey | IBFCVGVKGFZRAV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |