C17H19N2S+ — CID 177469325
(2E)-3-methyl-2-[(1,2,6-trimethylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole (PubChem CID 177469325) has the molecular formula C17H19N2S+ and a molecular weight of 283.42 g/mol. Its IUPAC name is (2E)-3-methyl-2-[(1,2,6-trimethylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole.
| Compound Name | (2E)-3-methyl-2-[(1,2,6-trimethylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 177469325 |
| Molecular Formula | C17H19N2S+ |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (2E)-3-methyl-2-[(1,2,6-trimethylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
| SMILES | Cc1cc(/C=C2/Sc3ccccc3N2C)cc(C)[n+]1C |
| InChI | InChI=1S/C17H19N2S/c1-12-9-14(10-13(2)18(12)3)11-17-19(4)15-7-5-6-8-16(15)20-17/h5-11H,1-4H3/q+1 |
| InChIKey | VEIQOBXDHSRTAH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|