C20H25IN2S — CID 73242563
2-[(1-butan-2-yl-2,6-dimethylpyridin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide (PubChem CID 73242563) has the molecular formula C20H25IN2S and a molecular weight of 452.41 g/mol. Its IUPAC name is 2-[(1-butan-2-yl-2,6-dimethylpyridin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide.
| Compound Name | 2-[(1-butan-2-yl-2,6-dimethylpyridin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 73242563 |
| Molecular Formula | C20H25IN2S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[(1-butan-2-yl-2,6-dimethylpyridin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole iodide |
| SMILES | CCC(C)[n+]1c(C)cc(C=C2Sc3ccccc3N2C)cc1C.[I-] |
| InChI | InChI=1S/C20H25N2S.HI/c1-6-14(2)22-15(3)11-17(12-16(22)4)13-20-21(5)18-9-7-8-10-19(18)23-20;/h7-14H,6H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | MHGAKTVTKCWYDD-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|