C20H23N2O2S+ — CID 134067577
4-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]butanoic acid (PubChem CID 134067577) has the molecular formula C20H23N2O2S+ and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]butanoic acid.
| Compound Name | 4-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]butanoic acid |
|---|---|
| PubChem CID | 134067577 |
| Molecular Formula | C20H23N2O2S+ |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]butanoic acid |
| SMILES | Cc1cc(/C=C2\Sc3ccccc3N2C)cc(C)[n+]1CCCC(=O)O |
| InChI | InChI=1S/C20H22N2O2S/c1-14-11-16(12-15(2)22(14)10-6-9-20(23)24)13-19-21(3)17-7-4-5-8-18(17)25-19/h4-5,7-8,11-13H,6,9-10H2,1-3H3/p+1 |
| InChIKey | ZWGNGTZZHJFOAE-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|