C24H32N3OS+ — CID 2315425
4-[3-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]propyl]morpholine (PubChem CID 2315425) has the molecular formula C24H32N3OS+ and a molecular weight of 410.61 g/mol. Its IUPAC name is 4-[3-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]propyl]morpholine.
| Compound Name | 4-[3-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 2315425 |
| Molecular Formula | C24H32N3OS+ |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-[3-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]propyl]morpholine |
| SMILES | CCN1C(=Cc2cc(C)[n+](CCCN3CCOCC3)c(C)c2)Sc2ccccc21 |
| InChI | InChI=1S/C24H32N3OS/c1-4-26-22-8-5-6-9-23(22)29-24(26)18-21-16-19(2)27(20(3)17-21)11-7-10-25-12-14-28-15-13-25/h5-6,8-9,16-18H,4,7,10-15H2,1-3H3/q+1 |
| InChIKey | DXOJIJLGTYJXEG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|