C25H28IN3O2S2 — CID 73242443
4-[2-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]ethyl]benzenesulfonamide iodide (PubChem CID 73242443) has the molecular formula C25H28IN3O2S2 and a molecular weight of 593.56 g/mol. Its IUPAC name is 4-[2-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]ethyl]benzenesulfonamide iodide.
| Compound Name | 4-[2-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]ethyl]benzenesulfonamide iodide |
|---|---|
| PubChem CID | 73242443 |
| Molecular Formula | C25H28IN3O2S2 |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | 4-[2-[4-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,6-dimethylpyridin-1-ium-1-yl]ethyl]benzenesulfonamide iodide |
| SMILES | CCN1C(=Cc2cc(C)[n+](CCc3ccc(S(N)(=O)=O)cc3)c(C)c2)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C25H28N3O2S2.HI/c1-4-27-23-7-5-6-8-24(23)31-25(27)17-21-15-18(2)28(19(3)16-21)14-13-20-9-11-22(12-10-20)32(26,29)30;/h5-12,15-17H,4,13-14H2,1-3H3,(H2,26,29,30);1H/q+1;/p-1 |
| InChIKey | UPEQPRYZMPZACX-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 67.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|