C23H27IN4S — CID 136577484
(2E)-3-ethyl-2-[[1-(3-imidazol-1-ylpropyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole iodide (PubChem CID 136577484) has the molecular formula C23H27IN4S and a molecular weight of 518.47 g/mol. Its IUPAC name is (2E)-3-ethyl-2-[[1-(3-imidazol-1-ylpropyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole iodide.
| Compound Name | (2E)-3-ethyl-2-[[1-(3-imidazol-1-ylpropyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 136577484 |
| Molecular Formula | C23H27IN4S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | (2E)-3-ethyl-2-[[1-(3-imidazol-1-ylpropyl)-2,6-dimethylpyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole iodide |
| SMILES | CCN1/C(=C\c2cc(C)[n+](CCCn3ccnc3)c(C)c2)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C23H27N4S.HI/c1-4-26-21-8-5-6-9-22(21)28-23(26)16-20-14-18(2)27(19(3)15-20)12-7-11-25-13-10-24-17-25;/h5-6,8-10,13-17H,4,7,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | JPIIMWQJDLUPFU-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|