C28H25N2S+ — CID 75984175
3-ethyl-2-[(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole (PubChem CID 75984175) has the molecular formula C28H25N2S+ and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-ethyl-2-[(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 75984175 |
| Molecular Formula | C28H25N2S+ |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-ethyl-2-[(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
| SMILES | CCN1C(=Cc2cc(-c3ccccc3)[n+](C)c(-c3ccccc3)c2)Sc2ccccc21 |
| InChI | InChI=1S/C28H25N2S/c1-3-30-24-16-10-11-17-27(24)31-28(30)20-21-18-25(22-12-6-4-7-13-22)29(2)26(19-21)23-14-8-5-9-15-23/h4-20H,3H2,1-2H3/q+1 |
| InChIKey | ANRCYQFPGRENCT-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|