C26H23N2OS+ — CID 44817043
2-[(2E)-2-[(1-methyl-2-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol (PubChem CID 44817043) has the molecular formula C26H23N2OS+ and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[(2E)-2-[(1-methyl-2-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol.
| Compound Name | 2-[(2E)-2-[(1-methyl-2-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 44817043 |
| Molecular Formula | C26H23N2OS+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[(2E)-2-[(1-methyl-2-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol |
| SMILES | C[n+]1c(-c2ccccc2)cc(/C=C2/Sc3ccccc3N2CCO)c2ccccc21 |
| InChI | InChI=1S/C26H23N2OS/c1-27-22-12-6-5-11-21(22)20(17-24(27)19-9-3-2-4-10-19)18-26-28(15-16-29)23-13-7-8-14-25(23)30-26/h2-14,17-18,29H,15-16H2,1H3/q+1 |
| InChIKey | KSYBZCRWLSNWPX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|