C39H40N3OS+ — CID 164844429
4-[(2E)-2-[(E)-3-[1-(4-aminobutyl)-2-(4-phenylphenyl)quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]butan-1-ol (PubChem CID 164844429) has the molecular formula C39H40N3OS+ and a molecular weight of 598.84 g/mol. Its IUPAC name is 4-[(2E)-2-[(E)-3-[1-(4-aminobutyl)-2-(4-phenylphenyl)quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]butan-1-ol.
| Compound Name | 4-[(2E)-2-[(E)-3-[1-(4-aminobutyl)-2-(4-phenylphenyl)quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 164844429 |
| Molecular Formula | C39H40N3OS+ |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 4-[(2E)-2-[(E)-3-[1-(4-aminobutyl)-2-(4-phenylphenyl)quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]butan-1-ol |
| SMILES | NCCCC[n+]1c(-c2ccc(-c3ccccc3)cc2)cc(/C=C/C=C2/Sc3ccccc3N2CCCCO)c2ccccc21 |
| InChI | InChI=1S/C39H40N3OS/c40-25-8-9-26-41-35-17-5-4-16-34(35)33(29-37(41)32-23-21-31(22-24-32)30-13-2-1-3-14-30)15-12-20-39-42(27-10-11-28-43)36-18-6-7-19-38(36)44-39/h1-7,12-24,29,43H,8-11,25-28,40H2/q+1 |
| InChIKey | HTAFSMNLXOSBPB-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 53.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|