C33H34BF6N4O6S3+ — CID 167542620
[2-[[2-phenyl-1-[4-(trifluoromethylsulfonylamino)butyl]quinolin-1-ium-4-yl]methylidene]-3-[4-(trifluoromethylsulfonylamino)butyl]-1,3-benzothiazol-5-yl]boronic acid (PubChem CID 167542620) has the molecular formula C33H34BF6N4O6S3+ and a molecular weight of 803.66 g/mol. Its IUPAC name is [2-[[2-phenyl-1-[4-(trifluoromethylsulfonylamino)butyl]quinolin-1-ium-4-yl]methylidene]-3-[4-(trifluoromethylsulfonylamino)butyl]-1,3-benzothiazol-5-yl]boronic acid.
| Compound Name | [2-[[2-phenyl-1-[4-(trifluoromethylsulfonylamino)butyl]quinolin-1-ium-4-yl]methylidene]-3-[4-(trifluoromethylsulfonylamino)butyl]-1,3-benzothiazol-5-yl]boronic acid |
|---|---|
| PubChem CID | 167542620 |
| Molecular Formula | C33H34BF6N4O6S3+ |
| Molecular Weight | 803.66 g/mol |
| Exact Mass | 803.16 |
| IUPAC Name | [2-[[2-phenyl-1-[4-(trifluoromethylsulfonylamino)butyl]quinolin-1-ium-4-yl]methylidene]-3-[4-(trifluoromethylsulfonylamino)butyl]-1,3-benzothiazol-5-yl]boronic acid |
| SMILES | O=S(=O)(NCCCCN1C(=Cc2cc(-c3ccccc3)[n+](CCCCNS(=O)(=O)C(F)(F)F)c3ccccc23)Sc2ccc(B(O)O)cc21)C(F)(F)F |
| InChI | InChI=1S/C33H34BF6N4O6S3/c35-32(36,37)52(47,48)41-16-6-8-18-43-27-13-5-4-12-26(27)24(20-28(43)23-10-2-1-3-11-23)21-31-44(19-9-7-17-42-53(49,50)33(38,39)40)29-22-25(34(45)46)14-15-30(29)51-31/h1-5,10-15,20-22,41-42,45-46H,6-9,16-19H2/q+1 |
| InChIKey | BJSYSOKZEXQFGS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|