C26H28FN3O6S3 — CID 18714680
4-[2-[(Z)-[5-fluoro-3-[4-(methanesulfonamido)-4-oxobutyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-1-yl]butane-1-sulfonate (PubChem CID 18714680) has the molecular formula C26H28FN3O6S3 and a molecular weight of 593.72 g/mol. Its IUPAC name is 4-[2-[(Z)-[5-fluoro-3-[4-(methanesulfonamido)-4-oxobutyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[(Z)-[5-fluoro-3-[4-(methanesulfonamido)-4-oxobutyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 18714680 |
| Molecular Formula | C26H28FN3O6S3 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | 4-[2-[(Z)-[5-fluoro-3-[4-(methanesulfonamido)-4-oxobutyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CS(=O)(=O)NC(=O)CCCN1/C(=C/c2ccc3ccccc3[n+]2CCCCS(=O)(=O)[O-])Sc2ccc(F)cc21 |
| InChI | InChI=1S/C26H28FN3O6S3/c1-38(32,33)28-25(31)9-6-15-30-23-17-20(27)11-13-24(23)37-26(30)18-21-12-10-19-7-2-3-8-22(19)29(21)14-4-5-16-39(34,35)36/h2-3,7-8,10-13,17-18H,4-6,9,14-16H2,1H3,(H-,28,31,34,35,36) |
| InChIKey | RAHLOYRIZCMBPD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|